C11H11NO4 — CID 121224065
methyl (4S,5S)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxylate (PubChem CID 121224065) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is methyl (4S,5S)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl (4S,5S)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 121224065 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | methyl (4S,5S)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)[C@H]1NC(=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H11NO4/c1-15-10(13)8-9(16-11(14)12-8)7-5-3-2-4-6-7/h2-6,8-9H,1H3,(H,12,14)/t8-,9-/m0/s1 |
| InChIKey | VUJGQVSYRRJJQV-IUCAKERBSA-N |
| XLogP | 1.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |