C10H17NO4 — CID 139842666
ethyl 5-butyl-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 139842666) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is ethyl 5-butyl-2-oxo-1,3-oxazolidine-4-carboxylate.
| Compound Name | ethyl 5-butyl-2-oxo-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 139842666 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | ethyl 5-butyl-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | CCCCC1OC(=O)NC1C(=O)OCC |
| InChI | InChI=1S/C10H17NO4/c1-3-5-6-7-8(9(12)14-4-2)11-10(13)15-7/h7-8H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | QSXWFLVTALFTSZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |