C16H20ClNO4 — CID 57222590
ethyl 5-[4-(4-chlorophenyl)-2-oxo-1,3-oxazolidin-5-yl]pentanoate (PubChem CID 57222590) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is ethyl 5-[4-(4-chlorophenyl)-2-oxo-1,3-oxazolidin-5-yl]pentanoate.
| Compound Name | ethyl 5-[4-(4-chlorophenyl)-2-oxo-1,3-oxazolidin-5-yl]pentanoate |
|---|---|
| PubChem CID | 57222590 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | ethyl 5-[4-(4-chlorophenyl)-2-oxo-1,3-oxazolidin-5-yl]pentanoate |
| SMILES | CCOC(=O)CCCCC1OC(=O)NC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClNO4/c1-2-21-14(19)6-4-3-5-13-15(18-16(20)22-13)11-7-9-12(17)10-8-11/h7-10,13,15H,2-6H2,1H3,(H,18,20) |
| InChIKey | XISQGWPTELIOQJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|