C8H14ClNO2 — CID 15531680
(4R,5S)-4-butyl-5-(chloromethyl)-1,3-oxazolidin-2-one (PubChem CID 15531680) has the molecular formula C8H14ClNO2 and a molecular weight of 191.66 g/mol. Its IUPAC name is (4R,5S)-4-butyl-5-(chloromethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-butyl-5-(chloromethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15531680 |
| Molecular Formula | C8H14ClNO2 |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (4R,5S)-4-butyl-5-(chloromethyl)-1,3-oxazolidin-2-one |
| SMILES | CCCC[C@H]1NC(=O)O[C@@H]1CCl |
| InChI | InChI=1S/C8H14ClNO2/c1-2-3-4-6-7(5-9)12-8(11)10-6/h6-7H,2-5H2,1H3,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | ACDKSFLULSEDKZ-RNFRBKRXSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|