C12H22N2O2 — CID 102227097
(4S,5S)-5-(piperidin-1-ylmethyl)-4-propyl-1,3-oxazolidin-2-one (PubChem CID 102227097) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (4S,5S)-5-(piperidin-1-ylmethyl)-4-propyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-5-(piperidin-1-ylmethyl)-4-propyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102227097 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (4S,5S)-5-(piperidin-1-ylmethyl)-4-propyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@@H]1NC(=O)O[C@H]1CN1CCCCC1 |
| InChI | InChI=1S/C12H22N2O2/c1-2-6-10-11(16-12(15)13-10)9-14-7-4-3-5-8-14/h10-11H,2-9H2,1H3,(H,13,15)/t10-,11-/m0/s1 |
| InChIKey | LDELTENHPNMSCH-QWRGUYRKSA-N |
| XLogP | 1.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |