C8H12ClNO4 — CID 101119790
ethyl 2-[(4R,5S)-5-(chloromethyl)-2-oxo-1,3-oxazolidin-4-yl]acetate (PubChem CID 101119790) has the molecular formula C8H12ClNO4 and a molecular weight of 221.64 g/mol. Its IUPAC name is ethyl 2-[(4R,5S)-5-(chloromethyl)-2-oxo-1,3-oxazolidin-4-yl]acetate.
| Compound Name | ethyl 2-[(4R,5S)-5-(chloromethyl)-2-oxo-1,3-oxazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 101119790 |
| Molecular Formula | C8H12ClNO4 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | ethyl 2-[(4R,5S)-5-(chloromethyl)-2-oxo-1,3-oxazolidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1NC(=O)O[C@@H]1CCl |
| InChI | InChI=1S/C8H12ClNO4/c1-2-13-7(11)3-5-6(4-9)14-8(12)10-5/h5-6H,2-4H2,1H3,(H,10,12)/t5-,6-/m1/s1 |
| InChIKey | OBZPZLWDVAPQLS-PHDIDXHHSA-N |
| XLogP | 0.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|