C12H19NO5 — CID 162489735
ethyl 2-(4-butyl-2,6-dioxo-1,3-oxazinan-5-yl)acetate (PubChem CID 162489735) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl 2-(4-butyl-2,6-dioxo-1,3-oxazinan-5-yl)acetate.
| Compound Name | ethyl 2-(4-butyl-2,6-dioxo-1,3-oxazinan-5-yl)acetate |
|---|---|
| PubChem CID | 162489735 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | ethyl 2-(4-butyl-2,6-dioxo-1,3-oxazinan-5-yl)acetate |
| SMILES | CCCCC1NC(=O)OC(=O)C1CC(=O)OCC |
| InChI | InChI=1S/C12H19NO5/c1-3-5-6-9-8(7-10(14)17-4-2)11(15)18-12(16)13-9/h8-9H,3-7H2,1-2H3,(H,13,16) |
| InChIKey | BJVIKUITCWTDBE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|