C11H19NO3 — CID 131843994
ethyl 2-[(3R,4S)-3-ethyl-2-oxopiperidin-4-yl]acetate (PubChem CID 131843994) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is ethyl 2-[(3R,4S)-3-ethyl-2-oxopiperidin-4-yl]acetate.
| Compound Name | ethyl 2-[(3R,4S)-3-ethyl-2-oxopiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 131843994 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | ethyl 2-[(3R,4S)-3-ethyl-2-oxopiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCNC(=O)[C@@H]1CC |
| InChI | InChI=1S/C11H19NO3/c1-3-9-8(5-6-12-11(9)14)7-10(13)15-4-2/h8-9H,3-7H2,1-2H3,(H,12,14)/t8-,9+/m0/s1 |
| InChIKey | DQOBTPBMNAGKER-DTWKUNHWSA-N |
| XLogP | 1.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |