C16H23NO2 — CID 165473127
ethyl 2-(6-propyl-1,2,3,4-tetrahydroquinolin-4-yl)acetate (PubChem CID 165473127) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is ethyl 2-(6-propyl-1,2,3,4-tetrahydroquinolin-4-yl)acetate.
| Compound Name | ethyl 2-(6-propyl-1,2,3,4-tetrahydroquinolin-4-yl)acetate |
|---|---|
| PubChem CID | 165473127 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethyl 2-(6-propyl-1,2,3,4-tetrahydroquinolin-4-yl)acetate |
| SMILES | CCCc1ccc2c(c1)C(CC(=O)OCC)CCN2 |
| InChI | InChI=1S/C16H23NO2/c1-3-5-12-6-7-15-14(10-12)13(8-9-17-15)11-16(18)19-4-2/h6-7,10,13,17H,3-5,8-9,11H2,1-2H3 |
| InChIKey | QWBYXVXJQPFAQO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |