C16H21NO4 — CID 131974821
ethyl 3-[(1R,9R,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]propanoate (PubChem CID 131974821) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 3-[(1R,9R,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]propanoate.
| Compound Name | ethyl 3-[(1R,9R,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]propanoate |
|---|---|
| PubChem CID | 131974821 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl 3-[(1R,9R,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc2c(c1)[C@H]1C[C@@H](N2)[C@H](O)CO1 |
| InChI | InChI=1S/C16H21NO4/c1-2-20-16(19)6-4-10-3-5-12-11(7-10)15-8-13(17-12)14(18)9-21-15/h3,5,7,13-15,17-18H,2,4,6,8-9H2,1H3/t13-,14-,15-/m1/s1 |
| InChIKey | UBXGLVVLUCZPSD-RBSFLKMASA-N |
| XLogP | 1.80 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |