C14H17NO4 — CID 131974807
3-[(1R,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]propanoic acid (PubChem CID 131974807) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[(1R,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]propanoic acid.
| Compound Name | 3-[(1R,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]propanoic acid |
|---|---|
| PubChem CID | 131974807 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-[(1R,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1ccc2c(c1)[C@H]1C[C@H](N2)[C@H](O)CO1 |
| InChI | InChI=1S/C14H17NO4/c16-12-7-19-13-6-11(12)15-10-3-1-8(5-9(10)13)2-4-14(17)18/h1,3,5,11-13,15-16H,2,4,6-7H2,(H,17,18)/t11-,12+,13+/m0/s1 |
| InChIKey | KZACULVDXPGSOO-YNEHKIRRSA-N |
| XLogP | 1.32 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |