C19H27NO4 — CID 158538540
tert-butyl 4-[(1R,9R,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]butanoate (PubChem CID 158538540) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl 4-[(1R,9R,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]butanoate.
| Compound Name | tert-butyl 4-[(1R,9R,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]butanoate |
|---|---|
| PubChem CID | 158538540 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl 4-[(1R,9R,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCc1ccc2c(c1)[C@H]1C[C@@H](N2)[C@H](O)CO1 |
| InChI | InChI=1S/C19H27NO4/c1-19(2,3)24-18(22)6-4-5-12-7-8-14-13(9-12)17-10-15(20-14)16(21)11-23-17/h7-9,15-17,20-21H,4-6,10-11H2,1-3H3/t15-,16-,17-/m1/s1 |
| InChIKey | HNBKDHPUTAUVLP-BRWVUGGUSA-N |
| XLogP | 2.97 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |