C27H33N3O4S — CID 130476228
3-[(1S,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-N-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide (PubChem CID 130476228) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is 3-[(1S,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-N-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide.
| Compound Name | 3-[(1S,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-N-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 130476228 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 3-[(1S,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]-N-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]propanamide |
| SMILES | CSc1ccccc1[C@H]1CCCN1C(=O)CNC(=O)CCc1ccc2c(c1)[C@@H]1C[C@H](N2)[C@H](O)CO1 |
| InChI | InChI=1S/C27H33N3O4S/c1-35-25-7-3-2-5-18(25)22-6-4-12-30(22)27(33)15-28-26(32)11-9-17-8-10-20-19(13-17)24-14-21(29-20)23(31)16-34-24/h2-3,5,7-8,10,13,21-24,29,31H,4,6,9,11-12,14-16H2,1H3,(H,28,32)/t21-,22+,23+,24-/m0/s1 |
| InChIKey | LLPDSVYYHXDFPA-KEZOAJOQSA-N |
| XLogP | 3.44 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |