C26H34N4O4S — CID 131980742
1-[[(2R,5R)-5-ethyl-2-hydroxy-1,2,3,5-tetrahydro-4,1-benzoxazepin-7-yl]methyl]-3-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]urea (PubChem CID 131980742) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is 1-[[(2R,5R)-5-ethyl-2-hydroxy-1,2,3,5-tetrahydro-4,1-benzoxazepin-7-yl]methyl]-3-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]urea.
| Compound Name | 1-[[(2R,5R)-5-ethyl-2-hydroxy-1,2,3,5-tetrahydro-4,1-benzoxazepin-7-yl]methyl]-3-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 131980742 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 1-[[(2R,5R)-5-ethyl-2-hydroxy-1,2,3,5-tetrahydro-4,1-benzoxazepin-7-yl]methyl]-3-[2-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]-2-oxoethyl]urea |
| SMILES | CC[C@H]1OC[C@@H](O)Nc2ccc(CNC(=O)NCC(=O)N3CCC[C@@H]3c3ccccc3SC)cc21 |
| InChI | InChI=1S/C26H34N4O4S/c1-3-22-19-13-17(10-11-20(19)29-24(31)16-34-22)14-27-26(33)28-15-25(32)30-12-6-8-21(30)18-7-4-5-9-23(18)35-2/h4-5,7,9-11,13,21-22,24,29,31H,3,6,8,12,14-16H2,1-2H3,(H2,27,28,33)/t21-,22-,24-/m1/s1 |
| InChIKey | ACFMMNUIMDBODU-CQOQZXRMSA-N |
| XLogP | 3.78 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |