C19H27N3O5 — CID 146439998
ethyl 2-[[ethyl-[[(1R,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]methyl]carbamoyl]amino]acetate (PubChem CID 146439998) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is ethyl 2-[[ethyl-[[(1R,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]methyl]carbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[ethyl-[[(1R,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]methyl]carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 146439998 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethyl 2-[[ethyl-[[(1R,9S,10S)-10-hydroxy-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl]methyl]carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(CC)Cc1ccc2c(c1)[C@H]1C[C@H](N2)[C@H](O)CO1 |
| InChI | InChI=1S/C19H27N3O5/c1-3-22(19(25)20-9-18(24)26-4-2)10-12-5-6-14-13(7-12)17-8-15(21-14)16(23)11-27-17/h5-7,15-17,21,23H,3-4,8-11H2,1-2H3,(H,20,25)/t15-,16+,17+/m0/s1 |
| InChIKey | JGCTWNQTXNXLII-GVDBMIGSSA-N |
| XLogP | 1.40 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |