C22H18O7 — CID 102073502
dimethyl (3'S,4'S,5'S)-1,3-dioxo-5'-phenylspiro[indene-2,2'-oxolane]-3',4'-dicarboxylate (PubChem CID 102073502) has the molecular formula C22H18O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is dimethyl (3'S,4'S,5'S)-1,3-dioxo-5'-phenylspiro[indene-2,2'-oxolane]-3',4'-dicarboxylate.
| Compound Name | dimethyl (3'S,4'S,5'S)-1,3-dioxo-5'-phenylspiro[indene-2,2'-oxolane]-3',4'-dicarboxylate |
|---|---|
| PubChem CID | 102073502 |
| Molecular Formula | C22H18O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | dimethyl (3'S,4'S,5'S)-1,3-dioxo-5'-phenylspiro[indene-2,2'-oxolane]-3',4'-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)OC2(C(=O)c3ccccc3C2=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C22H18O7/c1-27-20(25)15-16(21(26)28-2)22(29-17(15)12-8-4-3-5-9-12)18(23)13-10-6-7-11-14(13)19(22)24/h3-11,15-17H,1-2H3/t15-,16+,17+/m0/s1 |
| InChIKey | WMOSOPQXBJQBCP-GVDBMIGSSA-N |
| XLogP | 2.15 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|