C29H21Cl2NO8 — CID 58715488
ethyl (4'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate (PubChem CID 58715488) has the molecular formula C29H21Cl2NO8 and a molecular weight of 582.39 g/mol. Its IUPAC name is ethyl (4'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate.
| Compound Name | ethyl (4'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate |
|---|---|
| PubChem CID | 58715488 |
| Molecular Formula | C29H21Cl2NO8 |
| Molecular Weight | 582.39 g/mol |
| Exact Mass | 581.06 |
| IUPAC Name | ethyl (4'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-5'-(3,4-dichlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylate |
| SMILES | CCOC(=O)C1[C@H](C(=O)Nc2ccc3c(c2)OCO3)C(c2ccc(Cl)c(Cl)c2)OC12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H21Cl2NO8/c1-2-37-28(36)23-22(27(35)32-15-8-10-20-21(12-15)39-13-38-20)24(14-7-9-18(30)19(31)11-14)40-29(23)25(33)16-5-3-4-6-17(16)26(29)34/h3-12,22-24H,2,13H2,1H3,(H,32,35)/t22-,23?,24?/m0/s1 |
| InChIKey | LDQORNRDQRGVLC-BOMBAVFCSA-N |
| XLogP | 5.05 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|