C28H21NO8 — CID 70840719
N-(1,3-benzodioxol-5-yl)-9-hydroxy-14-(4-methylphenyl)-2,11-dioxo-10,15-dioxatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-triene-13-carboxamide (PubChem CID 70840719) has the molecular formula C28H21NO8 and a molecular weight of 499.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-9-hydroxy-14-(4-methylphenyl)-2,11-dioxo-10,15-dioxatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-triene-13-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-9-hydroxy-14-(4-methylphenyl)-2,11-dioxo-10,15-dioxatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-triene-13-carboxamide |
|---|---|
| PubChem CID | 70840719 |
| Molecular Formula | C28H21NO8 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-9-hydroxy-14-(4-methylphenyl)-2,11-dioxo-10,15-dioxatetracyclo[7.6.0.01,12.03,8]pentadeca-3,5,7-triene-13-carboxamide |
| SMILES | Cc1ccc(C2OC34C(=O)c5ccccc5C3(O)OC(=O)C4C2C(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C28H21NO8/c1-14-6-8-15(9-7-14)23-21(25(31)29-16-10-11-19-20(12-16)35-13-34-19)22-26(32)37-28(33)18-5-3-2-4-17(18)24(30)27(22,28)36-23/h2-12,21-23,33H,13H2,1H3,(H,29,31) |
| InChIKey | DFBNBLFIKJHTHX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |