C20H24N2O5 — CID 154816407
ethyl (3aR,4R,5S,7aR)-2-(1,3-benzodioxol-5-ylcarbamoyl)-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate (PubChem CID 154816407) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is ethyl (3aR,4R,5S,7aR)-2-(1,3-benzodioxol-5-ylcarbamoyl)-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate.
| Compound Name | ethyl (3aR,4R,5S,7aR)-2-(1,3-benzodioxol-5-ylcarbamoyl)-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 154816407 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | ethyl (3aR,4R,5S,7aR)-2-(1,3-benzodioxol-5-ylcarbamoyl)-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2CN(C(=O)Nc3ccc4c(c3)OCO4)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C20H24N2O5/c1-3-25-19(23)18-12(2)4-5-13-9-22(10-15(13)18)20(24)21-14-6-7-16-17(8-14)27-11-26-16/h4-8,12-13,15,18H,3,9-11H2,1-2H3,(H,21,24)/t12-,13-,15+,18+/m0/s1 |
| InChIKey | HFEVRXUCTAEYMS-FHKFTOANSA-N |
| XLogP | 2.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|