C21H28N2O4 — CID 154564864
ethyl (3aS,4S,5S,7aR)-2-[(4-methoxy-2-methylphenyl)carbamoyl]-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate (PubChem CID 154564864) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is ethyl (3aS,4S,5S,7aR)-2-[(4-methoxy-2-methylphenyl)carbamoyl]-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,5S,7aR)-2-[(4-methoxy-2-methylphenyl)carbamoyl]-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 154564864 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | ethyl (3aS,4S,5S,7aR)-2-[(4-methoxy-2-methylphenyl)carbamoyl]-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CN(C(=O)Nc3ccc(OC)cc3C)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C21H28N2O4/c1-5-27-20(24)19-13(2)6-7-15-11-23(12-17(15)19)21(25)22-18-9-8-16(26-4)10-14(18)3/h6-10,13,15,17,19H,5,11-12H2,1-4H3,(H,22,25)/t13-,15-,17-,19-/m0/s1 |
| InChIKey | XCHFLSGNSOZWJF-CJCBUOBESA-N |
| XLogP | 3.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|