C23H26N2O4 — CID 154564210
ethyl (3aS,4S,5S,7aR)-2-(4-methoxyquinoline-2-carbonyl)-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate (PubChem CID 154564210) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is ethyl (3aS,4S,5S,7aR)-2-(4-methoxyquinoline-2-carbonyl)-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,5S,7aR)-2-(4-methoxyquinoline-2-carbonyl)-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 154564210 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | ethyl (3aS,4S,5S,7aR)-2-(4-methoxyquinoline-2-carbonyl)-5-methyl-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CN(C(=O)c3cc(OC)c4ccccc4n3)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C23H26N2O4/c1-4-29-23(27)21-14(2)9-10-15-12-25(13-17(15)21)22(26)19-11-20(28-3)16-7-5-6-8-18(16)24-19/h5-11,14-15,17,21H,4,12-13H2,1-3H3/t14-,15-,17-,21-/m0/s1 |
| InChIKey | YWQCQCAOGJPGIR-WLNNIECUSA-N |
| XLogP | 3.32 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|