C18H24N2O3 — CID 154571427
ethyl (3aS,4S,5S,7aR)-5-methyl-2-(2-methyl-1H-pyrrole-3-carbonyl)-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate (PubChem CID 154571427) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl (3aS,4S,5S,7aR)-5-methyl-2-(2-methyl-1H-pyrrole-3-carbonyl)-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,5S,7aR)-5-methyl-2-(2-methyl-1H-pyrrole-3-carbonyl)-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 154571427 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl (3aS,4S,5S,7aR)-5-methyl-2-(2-methyl-1H-pyrrole-3-carbonyl)-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CN(C(=O)c3cc[nH]c3C)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C18H24N2O3/c1-4-23-18(22)16-11(2)5-6-13-9-20(10-15(13)16)17(21)14-7-8-19-12(14)3/h5-8,11,13,15-16,19H,4,9-10H2,1-3H3/t11-,13-,15-,16-/m0/s1 |
| InChIKey | NTXDCRBHLVLIBZ-MZGVZZPPSA-N |
| XLogP | 2.40 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|