C17H21N7O3 — CID 155508784
ethyl (3aS,4S,5S,7aR)-5-methyl-2-[3-(tetrazol-1-yl)-1H-pyrazole-5-carbonyl]-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate (PubChem CID 155508784) has the molecular formula C17H21N7O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is ethyl (3aS,4S,5S,7aR)-5-methyl-2-[3-(tetrazol-1-yl)-1H-pyrazole-5-carbonyl]-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,5S,7aR)-5-methyl-2-[3-(tetrazol-1-yl)-1H-pyrazole-5-carbonyl]-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 155508784 |
| Molecular Formula | C17H21N7O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | ethyl (3aS,4S,5S,7aR)-5-methyl-2-[3-(tetrazol-1-yl)-1H-pyrazole-5-carbonyl]-1,3,3a,4,5,7a-hexahydroisoindole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CN(C(=O)c3cc(-n4cnnn4)n[nH]3)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C17H21N7O3/c1-3-27-17(26)15-10(2)4-5-11-7-23(8-12(11)15)16(25)13-6-14(20-19-13)24-9-18-21-22-24/h4-6,9-12,15H,3,7-8H2,1-2H3,(H,19,20)/t10-,11-,12-,15-/m0/s1 |
| InChIKey | DVOPNOLSNXISGT-ASHKBJFXSA-N |
| XLogP | 0.46 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|