C27H15Cl2NO7 — CID 11168623
(1S,3aS,6aR)-1-(1,3-benzodioxol-5-yl)-5-(3,4-dichlorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 11168623) has the molecular formula C27H15Cl2NO7 and a molecular weight of 536.32 g/mol. Its IUPAC name is (1S,3aS,6aR)-1-(1,3-benzodioxol-5-yl)-5-(3,4-dichlorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | (1S,3aS,6aR)-1-(1,3-benzodioxol-5-yl)-5-(3,4-dichlorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 11168623 |
| Molecular Formula | C27H15Cl2NO7 |
| Molecular Weight | 536.32 g/mol |
| Exact Mass | 535.02 |
| IUPAC Name | (1S,3aS,6aR)-1-(1,3-benzodioxol-5-yl)-5-(3,4-dichlorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | O=C1[C@H]2[C@@H](c3ccc4c(c3)OCO4)OC3(C(=O)c4ccccc4C3=O)[C@H]2C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H15Cl2NO7/c28-16-7-6-13(10-17(16)29)30-25(33)20-21(26(30)34)27(23(31)14-3-1-2-4-15(14)24(27)32)37-22(20)12-5-8-18-19(9-12)36-11-35-18/h1-10,20-22H,11H2/t20-,21-,22-/m1/s1 |
| InChIKey | JFUBEYQVXAPAOW-YPAWHYETSA-N |
| XLogP | 4.42 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|