C29H21NO7 — CID 5146942
5-(1,3-benzodioxol-5-yl)-1-(4-ethylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 5146942) has the molecular formula C29H21NO7 and a molecular weight of 495.49 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-1-(4-ethylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-1-(4-ethylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 5146942 |
| Molecular Formula | C29H21NO7 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-1-(4-ethylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | CCc1ccc(C2OC3(C(=O)c4ccccc4C3=O)C3C(=O)N(c4ccc5c(c4)OCO5)C(=O)C23)cc1 |
| InChI | InChI=1S/C29H21NO7/c1-2-15-7-9-16(10-8-15)24-22-23(29(37-24)25(31)18-5-3-4-6-19(18)26(29)32)28(34)30(27(22)33)17-11-12-20-21(13-17)36-14-35-20/h3-13,22-24H,2,14H2,1H3 |
| InChIKey | YELSCWIASXMNBH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|