C28H20FNO5 — CID 51579530
(1R,3aR,6aR)-1-(4-ethylphenyl)-5-(3-fluorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 51579530) has the molecular formula C28H20FNO5 and a molecular weight of 469.47 g/mol. Its IUPAC name is (1R,3aR,6aR)-1-(4-ethylphenyl)-5-(3-fluorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | (1R,3aR,6aR)-1-(4-ethylphenyl)-5-(3-fluorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 51579530 |
| Molecular Formula | C28H20FNO5 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | (1R,3aR,6aR)-1-(4-ethylphenyl)-5-(3-fluorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | CCc1ccc([C@@H]2OC3(C(=O)c4ccccc4C3=O)[C@@H]3C(=O)N(c4cccc(F)c4)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C28H20FNO5/c1-2-15-10-12-16(13-11-15)23-21-22(27(34)30(26(21)33)18-7-5-6-17(29)14-18)28(35-23)24(31)19-8-3-4-9-20(19)25(28)32/h3-14,21-23H,2H2,1H3/t21-,22+,23+/m1/s1 |
| InChIKey | PQCDRZGHTNVNDA-VJBWXMMDSA-N |
| XLogP | 4.08 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|