C28H18F3NO5 — CID 4518922
1-(4-methylphenyl)-5-[3-(trifluoromethyl)phenyl]spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 4518922) has the molecular formula C28H18F3NO5 and a molecular weight of 505.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-5-[3-(trifluoromethyl)phenyl]spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | 1-(4-methylphenyl)-5-[3-(trifluoromethyl)phenyl]spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 4518922 |
| Molecular Formula | C28H18F3NO5 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 1-(4-methylphenyl)-5-[3-(trifluoromethyl)phenyl]spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | Cc1ccc(C2OC3(C(=O)c4ccccc4C3=O)C3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C23)cc1 |
| InChI | InChI=1S/C28H18F3NO5/c1-14-9-11-15(12-10-14)22-20-21(27(37-22)23(33)18-7-2-3-8-19(18)24(27)34)26(36)32(25(20)35)17-6-4-5-16(13-17)28(29,30)31/h2-13,20-22H,1H3 |
| InChIKey | BDLFQAUUHXLWPF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|