C27H18BrNO5 — CID 6968433
(1R,3aS,6aS)-1-(4-bromophenyl)-5-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 6968433) has the molecular formula C27H18BrNO5 and a molecular weight of 516.35 g/mol. Its IUPAC name is (1R,3aS,6aS)-1-(4-bromophenyl)-5-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | (1R,3aS,6aS)-1-(4-bromophenyl)-5-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 6968433 |
| Molecular Formula | C27H18BrNO5 |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | (1R,3aS,6aS)-1-(4-bromophenyl)-5-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](c4ccc(Br)cc4)OC4(C(=O)c5ccccc5C4=O)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H18BrNO5/c1-14-6-12-17(13-7-14)29-25(32)20-21(26(29)33)27(34-22(20)15-8-10-16(28)11-9-15)23(30)18-4-2-3-5-19(18)24(27)31/h2-13,20-22H,1H3/t20-,21+,22-/m0/s1 |
| InChIKey | VUAMWUGAEXTRGG-BDTNDASRSA-N |
| XLogP | 4.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|