C28H19BrN2O6 — CID 98108973
N-[4-[(1R,3aR,6aR)-1-(4-bromophenyl)-1',3',4,6-tetraoxospiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl]phenyl]acetamide (PubChem CID 98108973) has the molecular formula C28H19BrN2O6 and a molecular weight of 559.37 g/mol. Its IUPAC name is N-[4-[(1R,3aR,6aR)-1-(4-bromophenyl)-1',3',4,6-tetraoxospiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl]phenyl]acetamide.
| Compound Name | N-[4-[(1R,3aR,6aR)-1-(4-bromophenyl)-1',3',4,6-tetraoxospiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 98108973 |
| Molecular Formula | C28H19BrN2O6 |
| Molecular Weight | 559.37 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | N-[4-[(1R,3aR,6aR)-1-(4-bromophenyl)-1',3',4,6-tetraoxospiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-5-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)C2(O[C@H]3c3ccc(Br)cc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H19BrN2O6/c1-14(32)30-17-10-12-18(13-11-17)31-26(35)21-22(27(31)36)28(37-23(21)15-6-8-16(29)9-7-15)24(33)19-4-2-3-5-20(19)25(28)34/h2-13,21-23H,1H3,(H,30,32)/t21-,22+,23+/m1/s1 |
| InChIKey | PBDLFARXVVBXFR-VJBWXMMDSA-N |
| XLogP | 4.10 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|