C26H15BrINO5 — CID 99692985
(1S,3aR,6aS)-5-(4-bromophenyl)-1-(3-iodophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 99692985) has the molecular formula C26H15BrINO5 and a molecular weight of 628.22 g/mol. Its IUPAC name is (1S,3aR,6aS)-5-(4-bromophenyl)-1-(3-iodophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | (1S,3aR,6aS)-5-(4-bromophenyl)-1-(3-iodophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 99692985 |
| Molecular Formula | C26H15BrINO5 |
| Molecular Weight | 628.22 g/mol |
| Exact Mass | 626.92 |
| IUPAC Name | (1S,3aR,6aS)-5-(4-bromophenyl)-1-(3-iodophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | O=C1[C@@H]2[C@@H](c3cccc(I)c3)OC3(C(=O)c4ccccc4C3=O)[C@@H]2C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H15BrINO5/c27-14-8-10-16(11-9-14)29-24(32)19-20(25(29)33)26(34-21(19)13-4-3-5-15(28)12-13)22(30)17-6-1-2-7-18(17)23(26)31/h1-12,19-21H/t19-,20-,21+/m0/s1 |
| InChIKey | OIOVCZZXHAXGNC-PCCBWWKXSA-N |
| XLogP | 4.75 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|