C26H15IN2O7 — CID 98169711
(1R,3aR,6aS)-1-(3-iodophenyl)-5-(4-nitrophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 98169711) has the molecular formula C26H15IN2O7 and a molecular weight of 594.32 g/mol. Its IUPAC name is (1R,3aR,6aS)-1-(3-iodophenyl)-5-(4-nitrophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | (1R,3aR,6aS)-1-(3-iodophenyl)-5-(4-nitrophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 98169711 |
| Molecular Formula | C26H15IN2O7 |
| Molecular Weight | 594.32 g/mol |
| Exact Mass | 593.99 |
| IUPAC Name | (1R,3aR,6aS)-1-(3-iodophenyl)-5-(4-nitrophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | O=C1[C@H]2[C@@H](C(=O)N1c1ccc([N+](=O)[O-])cc1)C1(O[C@H]2c2cccc(I)c2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H15IN2O7/c27-14-5-3-4-13(12-14)21-19-20(26(36-21)22(30)17-6-1-2-7-18(17)23(26)31)25(33)28(24(19)32)15-8-10-16(11-9-15)29(34)35/h1-12,19-21H/t19-,20-,21-/m0/s1 |
| InChIKey | HUMWITYZDYGYGP-ACRUOGEOSA-N |
| XLogP | 3.89 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|