C21H16O4 — CID 56594318
1,1-diacetyl-3-phenylspiro[cyclopropane-2,2'-indene]-1',3'-dione (PubChem CID 56594318) has the molecular formula C21H16O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1,1-diacetyl-3-phenylspiro[cyclopropane-2,2'-indene]-1',3'-dione.
| Compound Name | 1,1-diacetyl-3-phenylspiro[cyclopropane-2,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 56594318 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1,1-diacetyl-3-phenylspiro[cyclopropane-2,2'-indene]-1',3'-dione |
| SMILES | CC(=O)C1(C(C)=O)C(c2ccccc2)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H16O4/c1-12(22)20(13(2)23)17(14-8-4-3-5-9-14)21(20)18(24)15-10-6-7-11-16(15)19(21)25/h3-11,17H,1-2H3 |
| InChIKey | XYTQSJIROPWUTA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|