C14H13NO5 — CID 67378088
methyl 2-(2-amino-1,3-dioxoinden-2-yl)-3-oxobutanoate (PubChem CID 67378088) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl 2-(2-amino-1,3-dioxoinden-2-yl)-3-oxobutanoate.
| Compound Name | methyl 2-(2-amino-1,3-dioxoinden-2-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 67378088 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl 2-(2-amino-1,3-dioxoinden-2-yl)-3-oxobutanoate |
| SMILES | COC(=O)C(C(C)=O)C1(N)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H13NO5/c1-7(16)10(13(19)20-2)14(15)11(17)8-5-3-4-6-9(8)12(14)18/h3-6,10H,15H2,1-2H3 |
| InChIKey | VXXZCOCFRBKZNO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|