C21H15ClO6 — CID 56594577
dimethyl (3S)-3-(2-chlorophenyl)-1',3'-dioxospiro[cyclopropane-2,2'-indene]-1,1-dicarboxylate (PubChem CID 56594577) has the molecular formula C21H15ClO6 and a molecular weight of 398.80 g/mol. Its IUPAC name is dimethyl (3S)-3-(2-chlorophenyl)-1',3'-dioxospiro[cyclopropane-2,2'-indene]-1,1-dicarboxylate.
| Compound Name | dimethyl (3S)-3-(2-chlorophenyl)-1',3'-dioxospiro[cyclopropane-2,2'-indene]-1,1-dicarboxylate |
|---|---|
| PubChem CID | 56594577 |
| Molecular Formula | C21H15ClO6 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | dimethyl (3S)-3-(2-chlorophenyl)-1',3'-dioxospiro[cyclopropane-2,2'-indene]-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](c2ccccc2Cl)C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H15ClO6/c1-27-18(25)21(19(26)28-2)15(13-9-5-6-10-14(13)22)20(21)16(23)11-7-3-4-8-12(11)17(20)24/h3-10,15H,1-2H3/t15-/m0/s1 |
| InChIKey | DMTLOJRINFNVBI-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|