C19H15ClO4 — CID 46915328
methyl (1S,3aS,8bR)-1-(2-chlorophenyl)-3-oxo-4,8b-dihydro-1H-indeno[1,2-c]furan-3a-carboxylate (PubChem CID 46915328) has the molecular formula C19H15ClO4 and a molecular weight of 342.78 g/mol. Its IUPAC name is methyl (1S,3aS,8bR)-1-(2-chlorophenyl)-3-oxo-4,8b-dihydro-1H-indeno[1,2-c]furan-3a-carboxylate.
| Compound Name | methyl (1S,3aS,8bR)-1-(2-chlorophenyl)-3-oxo-4,8b-dihydro-1H-indeno[1,2-c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 46915328 |
| Molecular Formula | C19H15ClO4 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl (1S,3aS,8bR)-1-(2-chlorophenyl)-3-oxo-4,8b-dihydro-1H-indeno[1,2-c]furan-3a-carboxylate |
| SMILES | COC(=O)[C@]12Cc3ccccc3[C@H]1[C@@H](c1ccccc1Cl)OC2=O |
| InChI | InChI=1S/C19H15ClO4/c1-23-17(21)19-10-11-6-2-3-7-12(11)15(19)16(24-18(19)22)13-8-4-5-9-14(13)20/h2-9,15-16H,10H2,1H3/t15-,16+,19-/m0/s1 |
| InChIKey | WZJPUTCCXKYBRO-FCEWJHQRSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|