C17H11ClO4 — CID 13270885
methyl 2-chloro-2-(9,10-dioxoanthracen-1-yl)acetate (PubChem CID 13270885) has the molecular formula C17H11ClO4 and a molecular weight of 314.72 g/mol. Its IUPAC name is methyl 2-chloro-2-(9,10-dioxoanthracen-1-yl)acetate.
| Compound Name | methyl 2-chloro-2-(9,10-dioxoanthracen-1-yl)acetate |
|---|---|
| PubChem CID | 13270885 |
| Molecular Formula | C17H11ClO4 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | methyl 2-chloro-2-(9,10-dioxoanthracen-1-yl)acetate |
| SMILES | COC(=O)C(Cl)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H11ClO4/c1-22-17(21)14(18)11-7-4-8-12-13(11)16(20)10-6-3-2-5-9(10)15(12)19/h2-8,14H,1H3 |
| InChIKey | IEIWYRUTSURTQZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|