C17H13NO2 — CID 70616094
1-(1-aminoprop-2-enyl)anthracene-9,10-dione (PubChem CID 70616094) has the molecular formula C17H13NO2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(1-aminoprop-2-enyl)anthracene-9,10-dione.
| Compound Name | 1-(1-aminoprop-2-enyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 70616094 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-(1-aminoprop-2-enyl)anthracene-9,10-dione |
| SMILES | C=CC(N)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H13NO2/c1-2-14(18)12-8-5-9-13-15(12)17(20)11-7-4-3-6-10(11)16(13)19/h2-9,14H,1,18H2 |
| InChIKey | LMKWMOGJDKMHGI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|