About methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione
methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione (PubChem CID 87308714) has the molecular formula C17H16O6
and a molecular weight of 316.31 g/mol. Its IUPAC name is methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione.
Molecular Properties
| Compound Name | methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione |
| PubChem CID | 87308714 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione |
| SMILES | COC.O=C1c2ccccc2C(=O)c2c1cccc2C(O)(O)O |
| InChI | InChI=1S/C15H10O5.C2H6O/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18,19)20;1-3-2/h1-7,18-20H;1-2H3 |
| InChIKey | NDRRTUNKFRJPMK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione?
The IUPAC name of methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione (CID 87308714) is methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione.
What is the SMILES notation for methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione?
The canonical SMILES for methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione is COC.O=C1c2ccccc2C(=O)c2c1cccc2C(O)(O)O.
What is the InChIKey of methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione?
The InChIKey is NDRRTUNKFRJPMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O5.C2H6O/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18,19)20;1-3-2/h1-7,18-20H;1-2H3.
What are the key properties of methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione?
methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione has a molecular weight of 316.31 g/mol, XLogP of 0.81, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione is sourced from PubChem (CID 87308714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).