C17H16O6 — CID 87308714
methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione (PubChem CID 87308714) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione.
| Compound Name | methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 87308714 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methoxymethane;1-(trihydroxymethyl)anthracene-9,10-dione |
| SMILES | COC.O=C1c2ccccc2C(=O)c2c1cccc2C(O)(O)O |
| InChI | InChI=1S/C15H10O5.C2H6O/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18,19)20;1-3-2/h1-7,18-20H;1-2H3 |
| InChIKey | NDRRTUNKFRJPMK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|