C29H18O3 — CID 67759713
1-(3-hydroxy-3,3-diphenylprop-1-ynyl)anthracene-9,10-dione (PubChem CID 67759713) has the molecular formula C29H18O3 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-(3-hydroxy-3,3-diphenylprop-1-ynyl)anthracene-9,10-dione.
| Compound Name | 1-(3-hydroxy-3,3-diphenylprop-1-ynyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 67759713 |
| Molecular Formula | C29H18O3 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-(3-hydroxy-3,3-diphenylprop-1-ynyl)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(C#CC(O)(c3ccccc3)c3ccccc3)cccc21 |
| InChI | InChI=1S/C29H18O3/c30-27-23-15-7-8-16-24(23)28(31)26-20(10-9-17-25(26)27)18-19-29(32,21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-17,32H |
| InChIKey | MVASITQQPJNRPC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|