C24H14O3 — CID 122226295
1-[2-(4-acetylphenyl)ethynyl]anthracene-9,10-dione (PubChem CID 122226295) has the molecular formula C24H14O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-[2-(4-acetylphenyl)ethynyl]anthracene-9,10-dione.
| Compound Name | 1-[2-(4-acetylphenyl)ethynyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 122226295 |
| Molecular Formula | C24H14O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-[2-(4-acetylphenyl)ethynyl]anthracene-9,10-dione |
| SMILES | CC(=O)c1ccc(C#Cc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C24H14O3/c1-15(25)17-12-9-16(10-13-17)11-14-18-5-4-8-21-22(18)24(27)20-7-3-2-6-19(20)23(21)26/h2-10,12-13H,1H3 |
| InChIKey | AFGGTMJXJAPKLT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|