C16H10O4 — CID 12033048
2-acetyl-1-hydroxyanthracene-9,10-dione (PubChem CID 12033048) has the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-acetyl-1-hydroxyanthracene-9,10-dione.
| Compound Name | 2-acetyl-1-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 12033048 |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-acetyl-1-hydroxyanthracene-9,10-dione |
| SMILES | CC(=O)c1ccc2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H10O4/c1-8(17)9-6-7-12-13(15(9)19)16(20)11-5-3-2-4-10(11)14(12)18/h2-7,19H,1H3 |
| InChIKey | HRFNQGBHOJAYAH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|