C21H11ClO5 — CID 171983147
(4-chlorophenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 171983147) has the molecular formula C21H11ClO5 and a molecular weight of 378.77 g/mol. Its IUPAC name is (4-chlorophenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (4-chlorophenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 171983147 |
| Molecular Formula | C21H11ClO5 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | (4-chlorophenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1)c1ccc2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H11ClO5/c22-11-5-7-12(8-6-11)27-21(26)16-10-9-15-17(20(16)25)19(24)14-4-2-1-3-13(14)18(15)23/h1-10,25H |
| InChIKey | SDYRDCAIYLHSSB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|