C12H10O3S — CID 102166292
2,2-diacetyl-1-benzothiophen-3-one (PubChem CID 102166292) has the molecular formula C12H10O3S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2,2-diacetyl-1-benzothiophen-3-one.
| Compound Name | 2,2-diacetyl-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 102166292 |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 2,2-diacetyl-1-benzothiophen-3-one |
| SMILES | CC(=O)C1(C(C)=O)Sc2ccccc2C1=O |
| InChI | InChI=1S/C12H10O3S/c1-7(13)12(8(2)14)11(15)9-5-3-4-6-10(9)16-12/h3-6H,1-2H3 |
| InChIKey | AWAILSAEURBDCW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|