C10H10O2S — CID 88725230
2-methylprop-2-enoic acid;7-thiabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 88725230) has the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;7-thiabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2-methylprop-2-enoic acid;7-thiabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 88725230 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-methylprop-2-enoic acid;7-thiabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | C=C(C)C(=O)O.c1ccc2c(c1)S2 |
| InChI | InChI=1S/C6H4S.C4H6O2/c1-2-4-6-5(3-1)7-6;1-3(2)4(5)6/h1-4H;1H2,2H3,(H,5,6) |
| InChIKey | JDFQCYPHIJCSLX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|