C17H12N2O2S — CID 7714795
(2S)-5'-methyl-2'-phenylspiro[1-benzothiophene-2,4'-pyrazole]-3,3'-dione (PubChem CID 7714795) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is (2S)-5'-methyl-2'-phenylspiro[1-benzothiophene-2,4'-pyrazole]-3,3'-dione.
| Compound Name | (2S)-5'-methyl-2'-phenylspiro[1-benzothiophene-2,4'-pyrazole]-3,3'-dione |
|---|---|
| PubChem CID | 7714795 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (2S)-5'-methyl-2'-phenylspiro[1-benzothiophene-2,4'-pyrazole]-3,3'-dione |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@]12Sc1ccccc1C2=O |
| InChI | InChI=1S/C17H12N2O2S/c1-11-17(15(20)13-9-5-6-10-14(13)22-17)16(21)19(18-11)12-7-3-2-4-8-12/h2-10H,1H3/t17-/m0/s1 |
| InChIKey | LRKOCHAESZYRPT-KRWDZBQOSA-N |
| XLogP | 3.14 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|