C20H16N4O3 — CID 27234921
(5S,6R)-1,7-dimethyl-3,9-diphenyl-11-oxa-2,3,8,9-tetrazadispiro[4.0.46.15]undeca-1,7-diene-4,10-dione (PubChem CID 27234921) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is (5S,6R)-1,7-dimethyl-3,9-diphenyl-11-oxa-2,3,8,9-tetrazadispiro[4.0.46.15]undeca-1,7-diene-4,10-dione.
| Compound Name | (5S,6R)-1,7-dimethyl-3,9-diphenyl-11-oxa-2,3,8,9-tetrazadispiro[4.0.46.15]undeca-1,7-diene-4,10-dione |
|---|---|
| PubChem CID | 27234921 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (5S,6R)-1,7-dimethyl-3,9-diphenyl-11-oxa-2,3,8,9-tetrazadispiro[4.0.46.15]undeca-1,7-diene-4,10-dione |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@@]12O[C@]21C(=O)N(c2ccccc2)N=C1C |
| InChI | InChI=1S/C20H16N4O3/c1-13-19(17(25)23(21-13)15-9-5-3-6-10-15)20(27-19)14(2)22-24(18(20)26)16-11-7-4-8-12-16/h3-12H,1-2H3/t19-,20+ |
| InChIKey | XJAFBOLYABJBRZ-BGYRXZFFSA-N |
| XLogP | 2.34 |
| TPSA | 77.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|