C14H16N2O — CID 95562569
(3aR)-3a-methyl-2-phenyl-4,5,6,7-tetrahydroindazol-3-one (PubChem CID 95562569) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is (3aR)-3a-methyl-2-phenyl-4,5,6,7-tetrahydroindazol-3-one.
| Compound Name | (3aR)-3a-methyl-2-phenyl-4,5,6,7-tetrahydroindazol-3-one |
|---|---|
| PubChem CID | 95562569 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (3aR)-3a-methyl-2-phenyl-4,5,6,7-tetrahydroindazol-3-one |
| SMILES | C[C@@]12CCCCC1=NN(c1ccccc1)C2=O |
| InChI | InChI=1S/C14H16N2O/c1-14-10-6-5-9-12(14)15-16(13(14)17)11-7-3-2-4-8-11/h2-4,7-8H,5-6,9-10H2,1H3/t14-/m1/s1 |
| InChIKey | WGUHAEFYDBOPEH-CQSZACIVSA-N |
| XLogP | 2.97 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |