C11H13N3O3 — CID 15413209
5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one (PubChem CID 15413209) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one.
| Compound Name | 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 15413209 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one |
| SMILES | CN(C)C1=NN(c2ccccc2)C(=O)C1(O)O |
| InChI | InChI=1S/C11H13N3O3/c1-13(2)9-11(16,17)10(15)14(12-9)8-6-4-3-5-7-8/h3-7,16-17H,1-2H3 |
| InChIKey | SCMFOIHXERZTAH-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|