About 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one
5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one (PubChem CID 15413209) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one.
Molecular Properties
| Compound Name | 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one |
| PubChem CID | 15413209 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one |
| SMILES | CN(C)C1=NN(c2ccccc2)C(=O)C1(O)O |
| InChI | InChI=1S/C11H13N3O3/c1-13(2)9-11(16,17)10(15)14(12-9)8-6-4-3-5-7-8/h3-7,16-17H,1-2H3 |
| InChIKey | SCMFOIHXERZTAH-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one?
The IUPAC name of 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one (CID 15413209) is 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one.
What is the SMILES notation for 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one?
The canonical SMILES for 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one is CN(C)C1=NN(c2ccccc2)C(=O)C1(O)O.
What is the InChIKey of 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one?
The InChIKey is SCMFOIHXERZTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c1-13(2)9-11(16,17)10(15)14(12-9)8-6-4-3-5-7-8/h3-7,16-17H,1-2H3.
What are the key properties of 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one?
5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one has a molecular weight of 235.24 g/mol, XLogP of -0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-4,4-dihydroxy-2-phenylpyrazol-3-one is sourced from PubChem (CID 15413209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).