About N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide
N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide (PubChem CID 20788347) has the molecular formula C11H9Br2N3O2
and a molecular weight of 375.02 g/mol. Its IUPAC name is N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide |
| PubChem CID | 20788347 |
| Molecular Formula | C11H9Br2N3O2 |
| Molecular Weight | 375.02 g/mol |
| Exact Mass | 372.91 |
| IUPAC Name | N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide |
| SMILES | CC(=O)NC1=NN(c2ccccc2)C(=O)C1(Br)Br |
| InChI | InChI=1S/C11H9Br2N3O2/c1-7(17)14-9-11(12,13)10(18)16(15-9)8-5-3-2-4-6-8/h2-6H,1H3,(H,14,15,17) |
| InChIKey | OLAAGPZUJGZERG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.02 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide?
The IUPAC name of N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide (CID 20788347) is N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide.
What is the SMILES notation for N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide?
The canonical SMILES for N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide is CC(=O)NC1=NN(c2ccccc2)C(=O)C1(Br)Br.
What is the InChIKey of N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide?
The InChIKey is OLAAGPZUJGZERG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Br2N3O2/c1-7(17)14-9-11(12,13)10(18)16(15-9)8-5-3-2-4-6-8/h2-6H,1H3,(H,14,15,17).
What are the key properties of N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide?
N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide has a molecular weight of 375.02 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dibromo-5-oxo-1-phenylpyrazol-3-yl)acetamide is sourced from PubChem (CID 20788347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).