C28H29Cl3N6O3 — CID 18951918
N-(4-acetamido-4-anilino-5-oxo-1-phenylpyrazol-3-yl)-3,4,5-trichlorobenzamide;N-ethylethanamine (PubChem CID 18951918) has the molecular formula C28H29Cl3N6O3 and a molecular weight of 603.94 g/mol. Its IUPAC name is N-(4-acetamido-4-anilino-5-oxo-1-phenylpyrazol-3-yl)-3,4,5-trichlorobenzamide;N-ethylethanamine.
| Compound Name | N-(4-acetamido-4-anilino-5-oxo-1-phenylpyrazol-3-yl)-3,4,5-trichlorobenzamide;N-ethylethanamine |
|---|---|
| PubChem CID | 18951918 |
| Molecular Formula | C28H29Cl3N6O3 |
| Molecular Weight | 603.94 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | N-(4-acetamido-4-anilino-5-oxo-1-phenylpyrazol-3-yl)-3,4,5-trichlorobenzamide;N-ethylethanamine |
| SMILES | CC(=O)NC1(Nc2ccccc2)C(=O)N(c2ccccc2)N=C1NC(=O)c1cc(Cl)c(Cl)c(Cl)c1.CCNCC |
| InChI | InChI=1S/C24H18Cl3N5O3.C4H11N/c1-14(33)29-24(30-16-8-4-2-5-9-16)22(31-32(23(24)35)17-10-6-3-7-11-17)28-21(34)15-12-18(25)20(27)19(26)13-15;1-3-5-4-2/h2-13,30H,1H3,(H,29,33)(H,28,31,34);5H,3-4H2,1-2H3 |
| InChIKey | VMBZRUBBHGGKAC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|